C12H17ClN2O — CID 71392562
2-(3-benzyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol chloride (PubChem CID 71392562) has the molecular formula C12H17ClN2O and a molecular weight of 240.73 g/mol. Its IUPAC name is 2-(3-benzyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol chloride.
| Compound Name | 2-(3-benzyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol chloride |
|---|---|
| PubChem CID | 71392562 |
| Molecular Formula | C12H17ClN2O |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2-(3-benzyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol chloride |
| SMILES | OCC[NH+]1C=CN(Cc2ccccc2)C1.[Cl-] |
| InChI | InChI=1S/C12H16N2O.ClH/c15-9-8-13-6-7-14(11-13)10-12-4-2-1-3-5-12;/h1-7,15H,8-11H2;1H |
| InChIKey | URKUPYBZTYANSO-UHFFFAOYSA-N |
| XLogP | -3.19 |
| TPSA | 27.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | -3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |