About 3-benzyl-1,2-dihydroimidazole
3-benzyl-1,2-dihydroimidazole (PubChem CID 67392024) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 3-benzyl-1,2-dihydroimidazole.
Molecular Properties
| Compound Name | 3-benzyl-1,2-dihydroimidazole |
| PubChem CID | 67392024 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 3-benzyl-1,2-dihydroimidazole |
| SMILES | C1=CN(Cc2ccccc2)CN1 |
| InChI | InChI=1S/C10H12N2/c1-2-4-10(5-3-1)8-12-7-6-11-9-12/h1-7,11H,8-9H2 |
| InChIKey | KHQZGFSAEWKKFZ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-benzyl-1,2-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-1,2-dihydroimidazole?
The IUPAC name of 3-benzyl-1,2-dihydroimidazole (CID 67392024) is 3-benzyl-1,2-dihydroimidazole.
What is the SMILES notation for 3-benzyl-1,2-dihydroimidazole?
The canonical SMILES for 3-benzyl-1,2-dihydroimidazole is C1=CN(Cc2ccccc2)CN1.
What is the InChIKey of 3-benzyl-1,2-dihydroimidazole?
The InChIKey is KHQZGFSAEWKKFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-2-4-10(5-3-1)8-12-7-6-11-9-12/h1-7,11H,8-9H2.
What are the key properties of 3-benzyl-1,2-dihydroimidazole?
3-benzyl-1,2-dihydroimidazole has a molecular weight of 160.22 g/mol, XLogP of 1.52, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-1,2-dihydroimidazole is sourced from PubChem (CID 67392024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).