C17H19N2P — CID 135015866
2-(1,2-dihydroimidazol-3-yl)ethyl-diphenylphosphane (PubChem CID 135015866) has the molecular formula C17H19N2P and a molecular weight of 282.33 g/mol. Its IUPAC name is 2-(1,2-dihydroimidazol-3-yl)ethyl-diphenylphosphane.
| Compound Name | 2-(1,2-dihydroimidazol-3-yl)ethyl-diphenylphosphane |
|---|---|
| PubChem CID | 135015866 |
| Molecular Formula | C17H19N2P |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 2-(1,2-dihydroimidazol-3-yl)ethyl-diphenylphosphane |
| SMILES | C1=CN(CCP(c2ccccc2)c2ccccc2)CN1 |
| InChI | InChI=1S/C17H19N2P/c1-3-7-16(8-4-1)20(17-9-5-2-6-10-17)14-13-19-12-11-18-15-19/h1-12,18H,13-15H2 |
| InChIKey | TYGZOQIWCQFFSV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|