C16H25N3 — CID 142002633
N-benzyl-3-(1,2-dihydroimidazol-3-yl)-N-methylpropan-1-amine;ethene (PubChem CID 142002633) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is N-benzyl-3-(1,2-dihydroimidazol-3-yl)-N-methylpropan-1-amine;ethene.
| Compound Name | N-benzyl-3-(1,2-dihydroimidazol-3-yl)-N-methylpropan-1-amine;ethene |
|---|---|
| PubChem CID | 142002633 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | N-benzyl-3-(1,2-dihydroimidazol-3-yl)-N-methylpropan-1-amine;ethene |
| SMILES | C=C.CN(CCCN1C=CNC1)Cc1ccccc1 |
| InChI | InChI=1S/C14H21N3.C2H4/c1-16(12-14-6-3-2-4-7-14)9-5-10-17-11-8-15-13-17;1-2/h2-4,6-8,11,15H,5,9-10,12-13H2,1H3;1-2H2 |
| InChIKey | SXMBJWHRVKRPLI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|