C16H19IN2O2 — CID 114603823
1-[3-[benzyl(methyl)amino]propyl]-4-iodopyrrole-2-carboxylic acid (PubChem CID 114603823) has the molecular formula C16H19IN2O2 and a molecular weight of 398.24 g/mol. Its IUPAC name is 1-[3-[benzyl(methyl)amino]propyl]-4-iodopyrrole-2-carboxylic acid.
| Compound Name | 1-[3-[benzyl(methyl)amino]propyl]-4-iodopyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 114603823 |
| Molecular Formula | C16H19IN2O2 |
| Molecular Weight | 398.24 g/mol |
| Exact Mass | 398.05 |
| IUPAC Name | 1-[3-[benzyl(methyl)amino]propyl]-4-iodopyrrole-2-carboxylic acid |
| SMILES | CN(CCCn1cc(I)cc1C(=O)O)Cc1ccccc1 |
| InChI | InChI=1S/C16H19IN2O2/c1-18(11-13-6-3-2-4-7-13)8-5-9-19-12-14(17)10-15(19)16(20)21/h2-4,6-7,10,12H,5,8-9,11H2,1H3,(H,20,21) |
| InChIKey | ICNUGRLIGLFEHM-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.24 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|