C8H10INO3S — CID 114606745
4-iodo-1-(2-methylsulfinylethyl)pyrrole-2-carboxylic acid (PubChem CID 114606745) has the molecular formula C8H10INO3S and a molecular weight of 327.14 g/mol. Its IUPAC name is 4-iodo-1-(2-methylsulfinylethyl)pyrrole-2-carboxylic acid.
| Compound Name | 4-iodo-1-(2-methylsulfinylethyl)pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 114606745 |
| Molecular Formula | C8H10INO3S |
| Molecular Weight | 327.14 g/mol |
| Exact Mass | 326.94 |
| IUPAC Name | 4-iodo-1-(2-methylsulfinylethyl)pyrrole-2-carboxylic acid |
| SMILES | CS(=O)CCn1cc(I)cc1C(=O)O |
| InChI | InChI=1S/C8H10INO3S/c1-14(13)3-2-10-5-6(9)4-7(10)8(11)12/h4-5H,2-3H2,1H3,(H,11,12) |
| InChIKey | BTPMZTFKAVDFDD-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.14 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|