C11H15NO4S — CID 114606792
4-acetyl-1-(3-methylsulfinylpropyl)pyrrole-2-carboxylic acid (PubChem CID 114606792) has the molecular formula C11H15NO4S and a molecular weight of 257.31 g/mol. Its IUPAC name is 4-acetyl-1-(3-methylsulfinylpropyl)pyrrole-2-carboxylic acid.
| Compound Name | 4-acetyl-1-(3-methylsulfinylpropyl)pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 114606792 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 4-acetyl-1-(3-methylsulfinylpropyl)pyrrole-2-carboxylic acid |
| SMILES | CC(=O)c1cc(C(=O)O)n(CCCS(C)=O)c1 |
| InChI | InChI=1S/C11H15NO4S/c1-8(13)9-6-10(11(14)15)12(7-9)4-3-5-17(2)16/h6-7H,3-5H2,1-2H3,(H,14,15) |
| InChIKey | DYBNCARWGDWJSF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |