C11H15NO3 — CID 114603028
4-acetyl-1-butan-2-ylpyrrole-2-carboxylic acid (PubChem CID 114603028) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 4-acetyl-1-butan-2-ylpyrrole-2-carboxylic acid.
| Compound Name | 4-acetyl-1-butan-2-ylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 114603028 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 4-acetyl-1-butan-2-ylpyrrole-2-carboxylic acid |
| SMILES | CCC(C)n1cc(C(C)=O)cc1C(=O)O |
| InChI | InChI=1S/C11H15NO3/c1-4-7(2)12-6-9(8(3)13)5-10(12)11(14)15/h5-7H,4H2,1-3H3,(H,14,15) |
| InChIKey | LETJJXLMEBMFBP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |