C34H36IrP2 — CID 172852253
cycloocta-1,5-diene;2-diphenylphosphanylethyl(diphenyl)phosphane;iridium (PubChem CID 172852253) has the molecular formula C34H36IrP2 and a molecular weight of 698.83 g/mol. Its IUPAC name is cycloocta-1,5-diene;2-diphenylphosphanylethyl(diphenyl)phosphane;iridium.
| Compound Name | cycloocta-1,5-diene;2-diphenylphosphanylethyl(diphenyl)phosphane;iridium |
|---|---|
| PubChem CID | 172852253 |
| Molecular Formula | C34H36IrP2 |
| Molecular Weight | 698.83 g/mol |
| Exact Mass | 699.19 |
| IUPAC Name | cycloocta-1,5-diene;2-diphenylphosphanylethyl(diphenyl)phosphane;iridium |
| SMILES | C1=CCCC=CCC1.[Ir].c1ccc(P(CCP(c2ccccc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H24P2.C8H12.Ir/c1-5-13-23(14-6-1)27(24-15-7-2-8-16-24)21-22-28(25-17-9-3-10-18-25)26-19-11-4-12-20-26;1-2-4-6-8-7-5-3-1;/h1-20H,21-22H2;1-2,7-8H,3-6H2; |
| InChIKey | KXRZJMUUORHKPE-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.83 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|