C12H13NO — CID 19761155
1-benzyl-2,4-dihydropyridin-3-one (PubChem CID 19761155) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 1-benzyl-2,4-dihydropyridin-3-one.
| Compound Name | 1-benzyl-2,4-dihydropyridin-3-one |
|---|---|
| PubChem CID | 19761155 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 1-benzyl-2,4-dihydropyridin-3-one |
| SMILES | O=C1CC=CN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C12H13NO/c14-12-7-4-8-13(10-12)9-11-5-2-1-3-6-11/h1-6,8H,7,9-10H2 |
| InChIKey | HLDSXRABZRDPBF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |