About 2-benzyl-1H-pyrrolo[1,2-a]pyrazine;hydrobromide
2-benzyl-1H-pyrrolo[1,2-a]pyrazine;hydrobromide (PubChem CID 173446350) has the molecular formula C14H15BrN2
and a molecular weight of 291.19 g/mol. Its IUPAC name is 2-benzyl-1H-pyrrolo[1,2-a]pyrazine;hydrobromide.
Molecular Properties
| Compound Name | 2-benzyl-1H-pyrrolo[1,2-a]pyrazine;hydrobromide |
| PubChem CID | 173446350 |
| Molecular Formula | C14H15BrN2 |
| Molecular Weight | 291.19 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 2-benzyl-1H-pyrrolo[1,2-a]pyrazine;hydrobromide |
| SMILES | Br.C1=Cn2cccc2CN1Cc1ccccc1 |
| InChI | InChI=1S/C14H14N2.BrH/c1-2-5-13(6-3-1)11-15-9-10-16-8-4-7-14(16)12-15;/h1-10H,11-12H2;1H |
| InChIKey | VZAQIWKRJFSUAJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.19 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzyl-1H-pyrrolo[1,2-a]pyrazine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-1H-pyrrolo[1,2-a]pyrazine;hydrobromide?
The IUPAC name of 2-benzyl-1H-pyrrolo[1,2-a]pyrazine;hydrobromide (CID 173446350) is 2-benzyl-1H-pyrrolo[1,2-a]pyrazine;hydrobromide.
What is the SMILES notation for 2-benzyl-1H-pyrrolo[1,2-a]pyrazine;hydrobromide?
The canonical SMILES for 2-benzyl-1H-pyrrolo[1,2-a]pyrazine;hydrobromide is Br.C1=Cn2cccc2CN1Cc1ccccc1.
What is the InChIKey of 2-benzyl-1H-pyrrolo[1,2-a]pyrazine;hydrobromide?
The InChIKey is VZAQIWKRJFSUAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2.BrH/c1-2-5-13(6-3-1)11-15-9-10-16-8-4-7-14(16)12-15;/h1-10H,11-12H2;1H.
What are the key properties of 2-benzyl-1H-pyrrolo[1,2-a]pyrazine;hydrobromide?
2-benzyl-1H-pyrrolo[1,2-a]pyrazine;hydrobromide has a molecular weight of 291.19 g/mol, XLogP of 3.51, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-1H-pyrrolo[1,2-a]pyrazine;hydrobromide is sourced from PubChem (CID 173446350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).