C17H24N2 — CID 162060855
1-benzyl-2,3-dihydropyrrole;1-ethyl-2,3-dihydropyrrole (PubChem CID 162060855) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 1-benzyl-2,3-dihydropyrrole;1-ethyl-2,3-dihydropyrrole.
| Compound Name | 1-benzyl-2,3-dihydropyrrole;1-ethyl-2,3-dihydropyrrole |
|---|---|
| PubChem CID | 162060855 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 1-benzyl-2,3-dihydropyrrole;1-ethyl-2,3-dihydropyrrole |
| SMILES | C1=CN(Cc2ccccc2)CC1.CCN1C=CCC1 |
| InChI | InChI=1S/C11H13N.C6H11N/c1-2-6-11(7-3-1)10-12-8-4-5-9-12;1-2-7-5-3-4-6-7/h1-4,6-8H,5,9-10H2;3,5H,2,4,6H2,1H3 |
| InChIKey | YZUYZLADJSFGJR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |