C13H17N — CID 59011780
1-benzyl-4-methyl-3,4-dihydro-2H-pyridine (PubChem CID 59011780) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 1-benzyl-4-methyl-3,4-dihydro-2H-pyridine.
| Compound Name | 1-benzyl-4-methyl-3,4-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 59011780 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 1-benzyl-4-methyl-3,4-dihydro-2H-pyridine |
| SMILES | CC1C=CN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C13H17N/c1-12-7-9-14(10-8-12)11-13-5-3-2-4-6-13/h2-7,9,12H,8,10-11H2,1H3 |
| InChIKey | JLUWHCSNSUASGT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |