C14H16N2O2 — CID 69304370
8-benzyl-6,7-dihydro-1H-pyrazino[2,1-c][1,4]oxazin-4-one (PubChem CID 69304370) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 8-benzyl-6,7-dihydro-1H-pyrazino[2,1-c][1,4]oxazin-4-one.
| Compound Name | 8-benzyl-6,7-dihydro-1H-pyrazino[2,1-c][1,4]oxazin-4-one |
|---|---|
| PubChem CID | 69304370 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 8-benzyl-6,7-dihydro-1H-pyrazino[2,1-c][1,4]oxazin-4-one |
| SMILES | O=C1COCC2=CN(Cc3ccccc3)CCN12 |
| InChI | InChI=1S/C14H16N2O2/c17-14-11-18-10-13-9-15(6-7-16(13)14)8-12-4-2-1-3-5-12/h1-5,9H,6-8,10-11H2 |
| InChIKey | QDNXFAAAABXQJY-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |