About 1-methyl-3-(2-phenylethyl)-1,2-dihydroimidazol-1-ium chloride
1-methyl-3-(2-phenylethyl)-1,2-dihydroimidazol-1-ium chloride (PubChem CID 67523509) has the molecular formula C12H17ClN2
and a molecular weight of 224.74 g/mol. Its IUPAC name is 1-methyl-3-(2-phenylethyl)-1,2-dihydroimidazol-1-ium chloride.
Analyze 1-methyl-3-(2-phenylethyl)-1,2-dihydroimidazol-1-ium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-(2-phenylethyl)-1,2-dihydroimidazol-1-ium chloride?
The IUPAC name of 1-methyl-3-(2-phenylethyl)-1,2-dihydroimidazol-1-ium chloride (CID 67523509) is 1-methyl-3-(2-phenylethyl)-1,2-dihydroimidazol-1-ium chloride.
What is the SMILES notation for 1-methyl-3-(2-phenylethyl)-1,2-dihydroimidazol-1-ium chloride?
The canonical SMILES for 1-methyl-3-(2-phenylethyl)-1,2-dihydroimidazol-1-ium chloride is C[NH+]1C=CN(CCc2ccccc2)C1.[Cl-].
What is the InChIKey of 1-methyl-3-(2-phenylethyl)-1,2-dihydroimidazol-1-ium chloride?
The InChIKey is YGCVRQQBEIWIRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2.ClH/c1-13-9-10-14(11-13)8-7-12-5-3-2-4-6-12;/h2-6,9-10H,7-8,11H2,1H3;1H.
What are the key properties of 1-methyl-3-(2-phenylethyl)-1,2-dihydroimidazol-1-ium chloride?
1-methyl-3-(2-phenylethyl)-1,2-dihydroimidazol-1-ium chloride has a molecular weight of 224.74 g/mol, XLogP of -2.51, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-(2-phenylethyl)-1,2-dihydroimidazol-1-ium chloride is sourced from PubChem (CID 67523509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).