C17H21IN2 — CID 71375203
1-ethyl-3-(2-phenylethyl)-1,2-dihydrobenzimidazol-1-ium iodide (PubChem CID 71375203) has the molecular formula C17H21IN2 and a molecular weight of 380.27 g/mol. Its IUPAC name is 1-ethyl-3-(2-phenylethyl)-1,2-dihydrobenzimidazol-1-ium iodide.
| Compound Name | 1-ethyl-3-(2-phenylethyl)-1,2-dihydrobenzimidazol-1-ium iodide |
|---|---|
| PubChem CID | 71375203 |
| Molecular Formula | C17H21IN2 |
| Molecular Weight | 380.27 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 1-ethyl-3-(2-phenylethyl)-1,2-dihydrobenzimidazol-1-ium iodide |
| SMILES | CC[NH+]1CN(CCc2ccccc2)c2ccccc21.[I-] |
| InChI | InChI=1S/C17H20N2.HI/c1-2-18-14-19(17-11-7-6-10-16(17)18)13-12-15-8-4-3-5-9-15;/h3-11H,2,12-14H2,1H3;1H |
| InChIKey | CALDPWNWHFRVGP-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.27 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|