C11H10N2S — CID 143402060
4,5-dihydropyrrolo[1,2-b][1,2,5]benzothiadiazepine (PubChem CID 143402060) has the molecular formula C11H10N2S and a molecular weight of 202.28 g/mol. Its IUPAC name is 4,5-dihydropyrrolo[1,2-b][1,2,5]benzothiadiazepine.
| Compound Name | 4,5-dihydropyrrolo[1,2-b][1,2,5]benzothiadiazepine |
|---|---|
| PubChem CID | 143402060 |
| Molecular Formula | C11H10N2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 4,5-dihydropyrrolo[1,2-b][1,2,5]benzothiadiazepine |
| SMILES | c1ccc2c(c1)NCc1cccn1S2 |
| InChI | InChI=1S/C11H10N2S/c1-2-6-11-10(5-1)12-8-9-4-3-7-13(9)14-11/h1-7,12H,8H2 |
| InChIKey | UPPAVKWDZTYOOL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |