C6H6N2OS — CID 66810769
2-hydroxy-3H-1,2,3-benzothiadiazole (PubChem CID 66810769) has the molecular formula C6H6N2OS and a molecular weight of 154.19 g/mol. Its IUPAC name is 2-hydroxy-3H-1,2,3-benzothiadiazole.
| Compound Name | 2-hydroxy-3H-1,2,3-benzothiadiazole |
|---|---|
| PubChem CID | 66810769 |
| Molecular Formula | C6H6N2OS |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 154.02 |
| IUPAC Name | 2-hydroxy-3H-1,2,3-benzothiadiazole |
| SMILES | ON1Nc2ccccc2S1 |
| InChI | InChI=1S/C6H6N2OS/c9-8-7-5-3-1-2-4-6(5)10-8/h1-4,7,9H |
| InChIKey | PIBUSPPTGIUTHP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|