C6H7BN2O2S — CID 141298211
3H-1,2,3-benzothiadiazol-2-ylboronic acid (PubChem CID 141298211) has the molecular formula C6H7BN2O2S and a molecular weight of 182.01 g/mol. Its IUPAC name is 3H-1,2,3-benzothiadiazol-2-ylboronic acid.
| Compound Name | 3H-1,2,3-benzothiadiazol-2-ylboronic acid |
|---|---|
| PubChem CID | 141298211 |
| Molecular Formula | C6H7BN2O2S |
| Molecular Weight | 182.01 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | 3H-1,2,3-benzothiadiazol-2-ylboronic acid |
| SMILES | OB(O)N1Nc2ccccc2S1 |
| InChI | InChI=1S/C6H7BN2O2S/c10-7(11)9-8-5-3-1-2-4-6(5)12-9/h1-4,8,10-11H |
| InChIKey | WIVTXGOBJSOWEN-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.01 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|