C15H14INS — CID 175409275
3-benzyl-2-iodo-2-methyl-1,3-benzothiazole (PubChem CID 175409275) has the molecular formula C15H14INS and a molecular weight of 367.25 g/mol. Its IUPAC name is 3-benzyl-2-iodo-2-methyl-1,3-benzothiazole.
| Compound Name | 3-benzyl-2-iodo-2-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 175409275 |
| Molecular Formula | C15H14INS |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | 3-benzyl-2-iodo-2-methyl-1,3-benzothiazole |
| SMILES | CC1(I)Sc2ccccc2N1Cc1ccccc1 |
| InChI | InChI=1S/C15H14INS/c1-15(16)17(11-12-7-3-2-4-8-12)13-9-5-6-10-14(13)18-15/h2-10H,11H2,1H3 |
| InChIKey | FQMZVLSXAMLOCB-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|