C23H28N2O4S2 — CID 102119372
18,21-dioxa-15,24-dithia-2,8-diazatricyclo[23.4.0.09,14]nonacosa-1(29),9,11,13,25,27-hexaene-3,7-dione (PubChem CID 102119372) has the molecular formula C23H28N2O4S2 and a molecular weight of 460.62 g/mol. Its IUPAC name is 18,21-dioxa-15,24-dithia-2,8-diazatricyclo[23.4.0.09,14]nonacosa-1(29),9,11,13,25,27-hexaene-3,7-dione.
| Compound Name | 18,21-dioxa-15,24-dithia-2,8-diazatricyclo[23.4.0.09,14]nonacosa-1(29),9,11,13,25,27-hexaene-3,7-dione |
|---|---|
| PubChem CID | 102119372 |
| Molecular Formula | C23H28N2O4S2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 18,21-dioxa-15,24-dithia-2,8-diazatricyclo[23.4.0.09,14]nonacosa-1(29),9,11,13,25,27-hexaene-3,7-dione |
| SMILES | O=C1CCCC(=O)Nc2ccccc2SCCOCCOCCSc2ccccc2N1 |
| InChI | InChI=1S/C23H28N2O4S2/c26-22-10-5-11-23(27)25-19-7-2-4-9-21(19)31-17-15-29-13-12-28-14-16-30-20-8-3-1-6-18(20)24-22/h1-4,6-9H,5,10-17H2,(H,24,26)(H,25,27) |
| InChIKey | PHNVIWACEUWAQX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |