C13H17NOS — CID 176725947
7-tert-butyl-3,5-dihydro-2H-1,5-benzothiazepin-4-one (PubChem CID 176725947) has the molecular formula C13H17NOS and a molecular weight of 235.35 g/mol. Its IUPAC name is 7-tert-butyl-3,5-dihydro-2H-1,5-benzothiazepin-4-one.
| Compound Name | 7-tert-butyl-3,5-dihydro-2H-1,5-benzothiazepin-4-one |
|---|---|
| PubChem CID | 176725947 |
| Molecular Formula | C13H17NOS |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 7-tert-butyl-3,5-dihydro-2H-1,5-benzothiazepin-4-one |
| SMILES | CC(C)(C)c1ccc2c(c1)NC(=O)CCS2 |
| InChI | InChI=1S/C13H17NOS/c1-13(2,3)9-4-5-11-10(8-9)14-12(15)6-7-16-11/h4-5,8H,6-7H2,1-3H3,(H,14,15) |
| InChIKey | BYKZSGLNGIUXTF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |