C11H15N3OS — CID 116855616
6-(1,2-diaminopropan-2-yl)-4H-1,4-benzothiazin-3-one (PubChem CID 116855616) has the molecular formula C11H15N3OS and a molecular weight of 237.33 g/mol. Its IUPAC name is 6-(1,2-diaminopropan-2-yl)-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-(1,2-diaminopropan-2-yl)-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 116855616 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 6-(1,2-diaminopropan-2-yl)-4H-1,4-benzothiazin-3-one |
| SMILES | CC(N)(CN)c1ccc2c(c1)NC(=O)CS2 |
| InChI | InChI=1S/C11H15N3OS/c1-11(13,6-12)7-2-3-9-8(4-7)14-10(15)5-16-9/h2-4H,5-6,12-13H2,1H3,(H,14,15) |
| InChIKey | WKAIGEIKTNKHOD-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |