C26H32O6S4 — CID 15646298
5,8,21,24-tetraoxa-2,11,18,27-tetrathiatricyclo[26.4.1.112,17]tetratriaconta-1(32),12,14,16,28,30-hexaene-33,34-dione (PubChem CID 15646298) has the molecular formula C26H32O6S4 and a molecular weight of 568.80 g/mol. Its IUPAC name is 5,8,21,24-tetraoxa-2,11,18,27-tetrathiatricyclo[26.4.1.112,17]tetratriaconta-1(32),12,14,16,28,30-hexaene-33,34-dione.
| Compound Name | 5,8,21,24-tetraoxa-2,11,18,27-tetrathiatricyclo[26.4.1.112,17]tetratriaconta-1(32),12,14,16,28,30-hexaene-33,34-dione |
|---|---|
| PubChem CID | 15646298 |
| Molecular Formula | C26H32O6S4 |
| Molecular Weight | 568.80 g/mol |
| Exact Mass | 568.11 |
| IUPAC Name | 5,8,21,24-tetraoxa-2,11,18,27-tetrathiatricyclo[26.4.1.112,17]tetratriaconta-1(32),12,14,16,28,30-hexaene-33,34-dione |
| SMILES | O=c1c2ccccc1SCCOCCOCCSc1ccccc(c1=O)SCCOCCOCCS2 |
| InChI | InChI=1S/C26H32O6S4/c27-25-21-5-1-2-6-22(25)34-18-14-30-11-12-32-16-20-36-24-8-4-3-7-23(26(24)28)35-19-15-31-10-9-29-13-17-33-21/h1-8H,9-20H2 |
| InChIKey | MAMCLBMXLOVZFO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.80 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |