C28H40O4S2 — CID 4144467
11,24-ditert-butyl-2,5,15,18-tetraoxa-8,21-dithiatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaene (PubChem CID 4144467) has the molecular formula C28H40O4S2 and a molecular weight of 504.76 g/mol. Its IUPAC name is 11,24-ditert-butyl-2,5,15,18-tetraoxa-8,21-dithiatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaene.
| Compound Name | 11,24-ditert-butyl-2,5,15,18-tetraoxa-8,21-dithiatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaene |
|---|---|
| PubChem CID | 4144467 |
| Molecular Formula | C28H40O4S2 |
| Molecular Weight | 504.76 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | 11,24-ditert-butyl-2,5,15,18-tetraoxa-8,21-dithiatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaene |
| SMILES | CC(C)(C)c1ccc2c(c1)SCCOCCOc1ccc(C(C)(C)C)cc1SCCOCCO2 |
| InChI | InChI=1S/C28H40O4S2/c1-27(2,3)21-7-9-23-25(19-21)33-17-15-29-12-14-32-24-10-8-22(28(4,5)6)20-26(24)34-18-16-30-11-13-31-23/h7-10,19-20H,11-18H2,1-6H3 |
| InChIKey | DJRSQTSMYDCCJA-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.76 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |