C47H46O6 — CID 102329639
15,35-ditert-butyl-7,11,23,27,39,43-hexaoxaheptacyclo[26.17.0.04,22.06,20.012,17.030,44.033,38]pentatetraconta-1(28),4(22),5,12(17),13,15,20,29,33(38),34,36,44-dodecaen-2,18,31-triyne (PubChem CID 102329639) has the molecular formula C47H46O6 and a molecular weight of 706.88 g/mol. Its IUPAC name is 15,35-ditert-butyl-7,11,23,27,39,43-hexaoxaheptacyclo[26.17.0.04,22.06,20.012,17.030,44.033,38]pentatetraconta-1(28),4(22),5,12(17),13,15,20,29,33(38),34,36,44-dodecaen-2,18,31-triyne.
| Compound Name | 15,35-ditert-butyl-7,11,23,27,39,43-hexaoxaheptacyclo[26.17.0.04,22.06,20.012,17.030,44.033,38]pentatetraconta-1(28),4(22),5,12(17),13,15,20,29,33(38),34,36,44-dodecaen-2,18,31-triyne |
|---|---|
| PubChem CID | 102329639 |
| Molecular Formula | C47H46O6 |
| Molecular Weight | 706.88 g/mol |
| Exact Mass | 706.33 |
| IUPAC Name | 15,35-ditert-butyl-7,11,23,27,39,43-hexaoxaheptacyclo[26.17.0.04,22.06,20.012,17.030,44.033,38]pentatetraconta-1(28),4(22),5,12(17),13,15,20,29,33(38),34,36,44-dodecaen-2,18,31-triyne |
| SMILES | CC(C)(C)c1ccc2c(c1)C#Cc1cc3c(cc1OCCCO2)C#Cc1cc2c(cc1OCCCO3)C#Cc1cc(C(C)(C)C)ccc1OCCCO2 |
| InChI | InChI=1S/C47H46O6/c1-46(2,3)38-16-18-40-32(26-38)10-12-34-28-44-36(30-42(34)50-22-7-20-48-40)14-15-37-31-43-35(29-45(37)53-25-9-24-52-44)13-11-33-27-39(47(4,5)6)17-19-41(33)49-21-8-23-51-43/h16-19,26-31H,7-9,20-25H2,1-6H3 |
| InChIKey | DSVOMMSEGNIGMK-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.88 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|