C29H44O6 — CID 43835335
11-tert-butyl-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(26),9(14),10,12,22,24-hexaene;2,2-dimethylpropane (PubChem CID 43835335) has the molecular formula C29H44O6 and a molecular weight of 488.67 g/mol. Its IUPAC name is 11-tert-butyl-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(26),9(14),10,12,22,24-hexaene;2,2-dimethylpropane.
| Compound Name | 11-tert-butyl-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(26),9(14),10,12,22,24-hexaene;2,2-dimethylpropane |
|---|---|
| PubChem CID | 43835335 |
| Molecular Formula | C29H44O6 |
| Molecular Weight | 488.67 g/mol |
| Exact Mass | 488.31 |
| IUPAC Name | 11-tert-butyl-2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(26),9(14),10,12,22,24-hexaene;2,2-dimethylpropane |
| SMILES | CC(C)(C)C.CC(C)(C)c1ccc2c(c1)OCCOCCOc1ccccc1OCCOCCO2 |
| InChI | InChI=1S/C24H32O6.C5H12/c1-24(2,3)19-8-9-22-23(18-19)30-17-13-26-11-15-28-21-7-5-4-6-20(21)27-14-10-25-12-16-29-22;1-5(2,3)4/h4-9,18H,10-17H2,1-3H3;1-4H3 |
| InChIKey | YAXOPFKXEWJVEL-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.67 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |