C18H20N2S2 — CID 91546944
3-(1,3,4,5-tetrahydro-2,4-benzothiazepin-8-yl)-2,3,4,5-tetrahydro-1,5-benzothiazepine (PubChem CID 91546944) has the molecular formula C18H20N2S2 and a molecular weight of 328.51 g/mol. Its IUPAC name is 3-(1,3,4,5-tetrahydro-2,4-benzothiazepin-8-yl)-2,3,4,5-tetrahydro-1,5-benzothiazepine.
| Compound Name | 3-(1,3,4,5-tetrahydro-2,4-benzothiazepin-8-yl)-2,3,4,5-tetrahydro-1,5-benzothiazepine |
|---|---|
| PubChem CID | 91546944 |
| Molecular Formula | C18H20N2S2 |
| Molecular Weight | 328.51 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 3-(1,3,4,5-tetrahydro-2,4-benzothiazepin-8-yl)-2,3,4,5-tetrahydro-1,5-benzothiazepine |
| SMILES | c1ccc2c(c1)NCC(c1ccc3c(c1)CSCNC3)CS2 |
| InChI | InChI=1S/C18H20N2S2/c1-2-4-18-17(3-1)20-9-16(11-22-18)13-5-6-14-8-19-12-21-10-15(14)7-13/h1-7,16,19-20H,8-12H2 |
| InChIKey | BQXBAESXIZWPPV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |