C13H15NO — CID 163949340
7-propan-2-yl-3,4-dihydroquinoline-2-carbaldehyde (PubChem CID 163949340) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 7-propan-2-yl-3,4-dihydroquinoline-2-carbaldehyde.
| Compound Name | 7-propan-2-yl-3,4-dihydroquinoline-2-carbaldehyde |
|---|---|
| PubChem CID | 163949340 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 7-propan-2-yl-3,4-dihydroquinoline-2-carbaldehyde |
| SMILES | CC(C)c1ccc2c(c1)N=C(C=O)CC2 |
| InChI | InChI=1S/C13H15NO/c1-9(2)11-4-3-10-5-6-12(8-15)14-13(10)7-11/h3-4,7-9H,5-6H2,1-2H3 |
| InChIKey | RXYQLBLQSNFBDS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|