About acetaldehyde;ethane;2-methyl-7-propan-2-yl-3,4-dihydro-1H-isoquinoline
acetaldehyde;ethane;2-methyl-7-propan-2-yl-3,4-dihydro-1H-isoquinoline (PubChem CID 176703540) has the molecular formula C17H29NO
and a molecular weight of 263.42 g/mol. Its IUPAC name is acetaldehyde;ethane;2-methyl-7-propan-2-yl-3,4-dihydro-1H-isoquinoline.
Molecular Properties
| Compound Name | acetaldehyde;ethane;2-methyl-7-propan-2-yl-3,4-dihydro-1H-isoquinoline |
| PubChem CID | 176703540 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | acetaldehyde;ethane;2-methyl-7-propan-2-yl-3,4-dihydro-1H-isoquinoline |
| SMILES | CC.CC(C)c1ccc2c(c1)CN(C)CC2.CC=O |
| InChI | InChI=1S/C13H19N.C2H4O.C2H6/c1-10(2)12-5-4-11-6-7-14(3)9-13(11)8-12;1-2-3;1-2/h4-5,8,10H,6-7,9H2,1-3H3;2H,1H3;1-2H3 |
| InChIKey | CCOCPEJXWDRBOL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;ethane;2-methyl-7-propan-2-yl-3,4-dihydro-1H-isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;ethane;2-methyl-7-propan-2-yl-3,4-dihydro-1H-isoquinoline?
The IUPAC name of acetaldehyde;ethane;2-methyl-7-propan-2-yl-3,4-dihydro-1H-isoquinoline (CID 176703540) is acetaldehyde;ethane;2-methyl-7-propan-2-yl-3,4-dihydro-1H-isoquinoline.
What is the SMILES notation for acetaldehyde;ethane;2-methyl-7-propan-2-yl-3,4-dihydro-1H-isoquinoline?
The canonical SMILES for acetaldehyde;ethane;2-methyl-7-propan-2-yl-3,4-dihydro-1H-isoquinoline is CC.CC(C)c1ccc2c(c1)CN(C)CC2.CC=O.
What is the InChIKey of acetaldehyde;ethane;2-methyl-7-propan-2-yl-3,4-dihydro-1H-isoquinoline?
The InChIKey is CCOCPEJXWDRBOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N.C2H4O.C2H6/c1-10(2)12-5-4-11-6-7-14(3)9-13(11)8-12;1-2-3;1-2/h4-5,8,10H,6-7,9H2,1-3H3;2H,1H3;1-2H3.
What are the key properties of acetaldehyde;ethane;2-methyl-7-propan-2-yl-3,4-dihydro-1H-isoquinoline?
acetaldehyde;ethane;2-methyl-7-propan-2-yl-3,4-dihydro-1H-isoquinoline has a molecular weight of 263.42 g/mol, XLogP of 4.03, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;ethane;2-methyl-7-propan-2-yl-3,4-dihydro-1H-isoquinoline is sourced from PubChem (CID 176703540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).