C13H19NO — CID 162779134
4-methyl-7-propan-2-yl-3,5-dihydro-2H-1,4-benzoxazepine (PubChem CID 162779134) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 4-methyl-7-propan-2-yl-3,5-dihydro-2H-1,4-benzoxazepine.
| Compound Name | 4-methyl-7-propan-2-yl-3,5-dihydro-2H-1,4-benzoxazepine |
|---|---|
| PubChem CID | 162779134 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 4-methyl-7-propan-2-yl-3,5-dihydro-2H-1,4-benzoxazepine |
| SMILES | CC(C)c1ccc2c(c1)CN(C)CCO2 |
| InChI | InChI=1S/C13H19NO/c1-10(2)11-4-5-13-12(8-11)9-14(3)6-7-15-13/h4-5,8,10H,6-7,9H2,1-3H3 |
| InChIKey | SWQVLFUHKGWOET-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |