C13H14OS — CID 123624961
4-(3-methyl-4,5-dihydrooxepin-2-yl)benzenethiol (PubChem CID 123624961) has the molecular formula C13H14OS and a molecular weight of 218.32 g/mol. Its IUPAC name is 4-(3-methyl-4,5-dihydrooxepin-2-yl)benzenethiol.
| Compound Name | 4-(3-methyl-4,5-dihydrooxepin-2-yl)benzenethiol |
|---|---|
| PubChem CID | 123624961 |
| Molecular Formula | C13H14OS |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 4-(3-methyl-4,5-dihydrooxepin-2-yl)benzenethiol |
| SMILES | CC1=C(c2ccc(S)cc2)OC=CCC1 |
| InChI | InChI=1S/C13H14OS/c1-10-4-2-3-9-14-13(10)11-5-7-12(15)8-6-11/h3,5-9,15H,2,4H2,1H3 |
| InChIKey | NIBVTLYSXGKWNK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|