About acetic acid;4-methylbenzenethiol
acetic acid;4-methylbenzenethiol (PubChem CID 70542625) has the molecular formula C9H12O2S
and a molecular weight of 184.26 g/mol. Its IUPAC name is acetic acid;4-methylbenzenethiol.
Molecular Properties
| Compound Name | acetic acid;4-methylbenzenethiol |
| PubChem CID | 70542625 |
| Molecular Formula | C9H12O2S |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | acetic acid;4-methylbenzenethiol |
| SMILES | CC(=O)O.Cc1ccc(S)cc1 |
| InChI | InChI=1S/C7H8S.C2H4O2/c1-6-2-4-7(8)5-3-6;1-2(3)4/h2-5,8H,1H3;1H3,(H,3,4) |
| InChIKey | HXXFDWYILOOMKM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;4-methylbenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;4-methylbenzenethiol?
The IUPAC name of acetic acid;4-methylbenzenethiol (CID 70542625) is acetic acid;4-methylbenzenethiol.
What is the SMILES notation for acetic acid;4-methylbenzenethiol?
The canonical SMILES for acetic acid;4-methylbenzenethiol is CC(=O)O.Cc1ccc(S)cc1.
What is the InChIKey of acetic acid;4-methylbenzenethiol?
The InChIKey is HXXFDWYILOOMKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8S.C2H4O2/c1-6-2-4-7(8)5-3-6;1-2(3)4/h2-5,8H,1H3;1H3,(H,3,4).
What are the key properties of acetic acid;4-methylbenzenethiol?
acetic acid;4-methylbenzenethiol has a molecular weight of 184.26 g/mol, XLogP of 2.37, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;4-methylbenzenethiol is sourced from PubChem (CID 70542625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).