C11H12OS — CID 162435420
4-(3,6-dihydro-2H-pyran-4-yl)benzenethiol (PubChem CID 162435420) has the molecular formula C11H12OS and a molecular weight of 192.28 g/mol. Its IUPAC name is 4-(3,6-dihydro-2H-pyran-4-yl)benzenethiol.
| Compound Name | 4-(3,6-dihydro-2H-pyran-4-yl)benzenethiol |
|---|---|
| PubChem CID | 162435420 |
| Molecular Formula | C11H12OS |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 4-(3,6-dihydro-2H-pyran-4-yl)benzenethiol |
| SMILES | Sc1ccc(C2=CCOCC2)cc1 |
| InChI | InChI=1S/C11H12OS/c13-11-3-1-9(2-4-11)10-5-7-12-8-6-10/h1-5,13H,6-8H2 |
| InChIKey | HBPXESWZDVBLAP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|