C14H24OS — CID 168899149
ethane;4-(5-methylthiophen-2-yl)-3,6-dihydro-2H-pyran (PubChem CID 168899149) has the molecular formula C14H24OS and a molecular weight of 240.41 g/mol. Its IUPAC name is ethane;4-(5-methylthiophen-2-yl)-3,6-dihydro-2H-pyran.
| Compound Name | ethane;4-(5-methylthiophen-2-yl)-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 168899149 |
| Molecular Formula | C14H24OS |
| Molecular Weight | 240.41 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | ethane;4-(5-methylthiophen-2-yl)-3,6-dihydro-2H-pyran |
| SMILES | CC.CC.Cc1ccc(C2=CCOCC2)s1 |
| InChI | InChI=1S/C10H12OS.2C2H6/c1-8-2-3-10(12-8)9-4-6-11-7-5-9;2*1-2/h2-4H,5-7H2,1H3;2*1-2H3 |
| InChIKey | MEJBGIPDUKRSSZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.41 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |