C8H10BNO3S — CID 169183764
[2-(3,6-dihydro-2H-pyran-4-yl)-1,3-thiazol-5-yl]boronic acid (PubChem CID 169183764) has the molecular formula C8H10BNO3S and a molecular weight of 211.05 g/mol. Its IUPAC name is [2-(3,6-dihydro-2H-pyran-4-yl)-1,3-thiazol-5-yl]boronic acid.
| Compound Name | [2-(3,6-dihydro-2H-pyran-4-yl)-1,3-thiazol-5-yl]boronic acid |
|---|---|
| PubChem CID | 169183764 |
| Molecular Formula | C8H10BNO3S |
| Molecular Weight | 211.05 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | [2-(3,6-dihydro-2H-pyran-4-yl)-1,3-thiazol-5-yl]boronic acid |
| SMILES | OB(O)c1cnc(C2=CCOCC2)s1 |
| InChI | InChI=1S/C8H10BNO3S/c11-9(12)7-5-10-8(14-7)6-1-3-13-4-2-6/h1,5,11-12H,2-4H2 |
| InChIKey | GQIWQVGPHGDCTJ-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.05 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|