C10H14N2O — CID 121273540
4-(3,6-dihydro-2H-pyran-4-yl)-3,5-dimethyl-1H-pyrazole (PubChem CID 121273540) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 4-(3,6-dihydro-2H-pyran-4-yl)-3,5-dimethyl-1H-pyrazole.
| Compound Name | 4-(3,6-dihydro-2H-pyran-4-yl)-3,5-dimethyl-1H-pyrazole |
|---|---|
| PubChem CID | 121273540 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 4-(3,6-dihydro-2H-pyran-4-yl)-3,5-dimethyl-1H-pyrazole |
| SMILES | Cc1n[nH]c(C)c1C1=CCOCC1 |
| InChI | InChI=1S/C10H14N2O/c1-7-10(8(2)12-11-7)9-3-5-13-6-4-9/h3H,4-6H2,1-2H3,(H,11,12) |
| InChIKey | KZEUCPYASKLRJO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |