C7H9N3 — CID 176900304
4-(cyclopropen-1-yl)-5-methyl-1H-pyrazol-3-amine (PubChem CID 176900304) has the molecular formula C7H9N3 and a molecular weight of 135.17 g/mol. Its IUPAC name is 4-(cyclopropen-1-yl)-5-methyl-1H-pyrazol-3-amine.
| Compound Name | 4-(cyclopropen-1-yl)-5-methyl-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 176900304 |
| Molecular Formula | C7H9N3 |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | 4-(cyclopropen-1-yl)-5-methyl-1H-pyrazol-3-amine |
| SMILES | Cc1[nH]nc(N)c1C1=CC1 |
| InChI | InChI=1S/C7H9N3/c1-4-6(5-2-3-5)7(8)10-9-4/h2H,3H2,1H3,(H3,8,9,10) |
| InChIKey | NMOIELLRAQOVBH-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |