C14H21F2N3O — CID 142528007
4-(2,6-difluorophenyl)-5-methyl-1H-pyrazol-3-amine;ethane;ethanol (PubChem CID 142528007) has the molecular formula C14H21F2N3O and a molecular weight of 285.34 g/mol. Its IUPAC name is 4-(2,6-difluorophenyl)-5-methyl-1H-pyrazol-3-amine;ethane;ethanol.
| Compound Name | 4-(2,6-difluorophenyl)-5-methyl-1H-pyrazol-3-amine;ethane;ethanol |
|---|---|
| PubChem CID | 142528007 |
| Molecular Formula | C14H21F2N3O |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 4-(2,6-difluorophenyl)-5-methyl-1H-pyrazol-3-amine;ethane;ethanol |
| SMILES | CC.CCO.Cc1[nH]nc(N)c1-c1c(F)cccc1F |
| InChI | InChI=1S/C10H9F2N3.C2H6O.C2H6/c1-5-8(10(13)15-14-5)9-6(11)3-2-4-7(9)12;1-2-3;1-2/h2-4H,1H3,(H3,13,14,15);3H,2H2,1H3;1-2H3 |
| InChIKey | MRFOCMMBVFFACV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |