C13H16ClNO3S — CID 162435558
N-(2-chloroethyl)-4-(3,6-dihydro-2H-pyran-4-yl)benzenesulfonamide (PubChem CID 162435558) has the molecular formula C13H16ClNO3S and a molecular weight of 301.80 g/mol. Its IUPAC name is N-(2-chloroethyl)-4-(3,6-dihydro-2H-pyran-4-yl)benzenesulfonamide.
| Compound Name | N-(2-chloroethyl)-4-(3,6-dihydro-2H-pyran-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 162435558 |
| Molecular Formula | C13H16ClNO3S |
| Molecular Weight | 301.80 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | N-(2-chloroethyl)-4-(3,6-dihydro-2H-pyran-4-yl)benzenesulfonamide |
| SMILES | O=S(=O)(NCCCl)c1ccc(C2=CCOCC2)cc1 |
| InChI | InChI=1S/C13H16ClNO3S/c14-7-8-15-19(16,17)13-3-1-11(2-4-13)12-5-9-18-10-6-12/h1-5,15H,6-10H2 |
| InChIKey | KHRYBKGEDZOAIP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.80 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|