C13H15F3N2O3S — CID 90101581
3-amino-4-(3,6-dihydro-2H-pyran-4-yl)-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 90101581) has the molecular formula C13H15F3N2O3S and a molecular weight of 336.34 g/mol. Its IUPAC name is 3-amino-4-(3,6-dihydro-2H-pyran-4-yl)-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 3-amino-4-(3,6-dihydro-2H-pyran-4-yl)-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 90101581 |
| Molecular Formula | C13H15F3N2O3S |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 3-amino-4-(3,6-dihydro-2H-pyran-4-yl)-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | Nc1cc(S(=O)(=O)NCC(F)(F)F)ccc1C1=CCOCC1 |
| InChI | InChI=1S/C13H15F3N2O3S/c14-13(15,16)8-18-22(19,20)10-1-2-11(12(17)7-10)9-3-5-21-6-4-9/h1-3,7,18H,4-6,8,17H2 |
| InChIKey | KJAJHBFHFITQAC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|