C17H16F3N3O5S2 — CID 172964832
(9Z)-7-N-ethyl-9-hydroxyimino-2-N-(2,2,2-trifluoroethyl)fluorene-2,7-disulfonamide (PubChem CID 172964832) has the molecular formula C17H16F3N3O5S2 and a molecular weight of 463.46 g/mol. Its IUPAC name is (9Z)-7-N-ethyl-9-hydroxyimino-2-N-(2,2,2-trifluoroethyl)fluorene-2,7-disulfonamide.
| Compound Name | (9Z)-7-N-ethyl-9-hydroxyimino-2-N-(2,2,2-trifluoroethyl)fluorene-2,7-disulfonamide |
|---|---|
| PubChem CID | 172964832 |
| Molecular Formula | C17H16F3N3O5S2 |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | (9Z)-7-N-ethyl-9-hydroxyimino-2-N-(2,2,2-trifluoroethyl)fluorene-2,7-disulfonamide |
| SMILES | CCNS(=O)(=O)c1ccc2c(c1)/C(=N/O)c1cc(S(=O)(=O)NCC(F)(F)F)ccc1-2 |
| InChI | InChI=1S/C17H16F3N3O5S2/c1-2-21-29(25,26)10-3-5-12-13-6-4-11(30(27,28)22-9-17(18,19)20)8-15(13)16(23-24)14(12)7-10/h3-8,21-22,24H,2,9H2,1H3/b23-16- |
| InChIKey | TWEPCODQMAJVIU-KQWNVCNZSA-N |
| XLogP | 2.03 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|