C27H23N3O5S2 — CID 1159157
9-hydroxyimino-2-N,7-N-bis(2-methylphenyl)fluorene-2,7-disulfonamide (PubChem CID 1159157) has the molecular formula C27H23N3O5S2 and a molecular weight of 533.63 g/mol. Its IUPAC name is 9-hydroxyimino-2-N,7-N-bis(2-methylphenyl)fluorene-2,7-disulfonamide.
| Compound Name | 9-hydroxyimino-2-N,7-N-bis(2-methylphenyl)fluorene-2,7-disulfonamide |
|---|---|
| PubChem CID | 1159157 |
| Molecular Formula | C27H23N3O5S2 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.11 |
| IUPAC Name | 9-hydroxyimino-2-N,7-N-bis(2-methylphenyl)fluorene-2,7-disulfonamide |
| SMILES | Cc1ccccc1NS(=O)(=O)c1ccc2c(c1)C(=NO)c1cc(S(=O)(=O)Nc3ccccc3C)ccc1-2 |
| InChI | InChI=1S/C27H23N3O5S2/c1-17-7-3-5-9-25(17)29-36(32,33)19-11-13-21-22-14-12-20(16-24(22)27(28-31)23(21)15-19)37(34,35)30-26-10-6-4-8-18(26)2/h3-16,29-31H,1-2H3 |
| InChIKey | PNWOKFNNUJWEBQ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|