C29H26N2O5S2 — CID 988110
2-N,7-N-bis(2,3-dimethylphenyl)-9-oxofluorene-2,7-disulfonamide (PubChem CID 988110) has the molecular formula C29H26N2O5S2 and a molecular weight of 546.67 g/mol. Its IUPAC name is 2-N,7-N-bis(2,3-dimethylphenyl)-9-oxofluorene-2,7-disulfonamide.
| Compound Name | 2-N,7-N-bis(2,3-dimethylphenyl)-9-oxofluorene-2,7-disulfonamide |
|---|---|
| PubChem CID | 988110 |
| Molecular Formula | C29H26N2O5S2 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.13 |
| IUPAC Name | 2-N,7-N-bis(2,3-dimethylphenyl)-9-oxofluorene-2,7-disulfonamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2ccc3c(c2)C(=O)c2cc(S(=O)(=O)Nc4cccc(C)c4C)ccc2-3)c1C |
| InChI | InChI=1S/C29H26N2O5S2/c1-17-7-5-9-27(19(17)3)30-37(33,34)21-11-13-23-24-14-12-22(16-26(24)29(32)25(23)15-21)38(35,36)31-28-10-6-8-18(2)20(28)4/h5-16,30-31H,1-4H3 |
| InChIKey | NIZOXWFUPALJJG-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 109.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |