C17H20N2O4S2 — CID 22583411
N-(2,3-dimethylphenyl)-1-methylsulfonyl-2,3-dihydroindole-5-sulfonamide (PubChem CID 22583411) has the molecular formula C17H20N2O4S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-1-methylsulfonyl-2,3-dihydroindole-5-sulfonamide.
| Compound Name | N-(2,3-dimethylphenyl)-1-methylsulfonyl-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 22583411 |
| Molecular Formula | C17H20N2O4S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | N-(2,3-dimethylphenyl)-1-methylsulfonyl-2,3-dihydroindole-5-sulfonamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2ccc3c(c2)CCN3S(C)(=O)=O)c1C |
| InChI | InChI=1S/C17H20N2O4S2/c1-12-5-4-6-16(13(12)2)18-25(22,23)15-7-8-17-14(11-15)9-10-19(17)24(3,20)21/h4-8,11,18H,9-10H2,1-3H3 |
| InChIKey | ICNCFNBFXQHTLT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |