C16H20N2O2S — CID 43099417
4-(1-aminoethyl)-N-(2,3-dimethylphenyl)benzenesulfonamide (PubChem CID 43099417) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is 4-(1-aminoethyl)-N-(2,3-dimethylphenyl)benzenesulfonamide.
| Compound Name | 4-(1-aminoethyl)-N-(2,3-dimethylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 43099417 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 4-(1-aminoethyl)-N-(2,3-dimethylphenyl)benzenesulfonamide |
| SMILES | Cc1cccc(NS(=O)(=O)c2ccc(C(C)N)cc2)c1C |
| InChI | InChI=1S/C16H20N2O2S/c1-11-5-4-6-16(12(11)2)18-21(19,20)15-9-7-14(8-10-15)13(3)17/h4-10,13,18H,17H2,1-3H3 |
| InChIKey | OXKNORAVSLGFLT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |