C14H16OS — CID 123871622
[4-(3-methyl-4,5-dihydrooxepin-2-yl)phenyl]methanethiol (PubChem CID 123871622) has the molecular formula C14H16OS and a molecular weight of 232.35 g/mol. Its IUPAC name is [4-(3-methyl-4,5-dihydrooxepin-2-yl)phenyl]methanethiol.
| Compound Name | [4-(3-methyl-4,5-dihydrooxepin-2-yl)phenyl]methanethiol |
|---|---|
| PubChem CID | 123871622 |
| Molecular Formula | C14H16OS |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | [4-(3-methyl-4,5-dihydrooxepin-2-yl)phenyl]methanethiol |
| SMILES | CC1=C(c2ccc(CS)cc2)OC=CCC1 |
| InChI | InChI=1S/C14H16OS/c1-11-4-2-3-9-15-14(11)13-7-5-12(10-16)6-8-13/h3,5-9,16H,2,4,10H2,1H3 |
| InChIKey | DCYVYQQRSKMERN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|