C11H11NOS2 — CID 10490065
[4-[5-(sulfanylmethyl)-1,2-oxazol-3-yl]phenyl]methanethiol (PubChem CID 10490065) has the molecular formula C11H11NOS2 and a molecular weight of 237.35 g/mol. Its IUPAC name is [4-[5-(sulfanylmethyl)-1,2-oxazol-3-yl]phenyl]methanethiol.
| Compound Name | [4-[5-(sulfanylmethyl)-1,2-oxazol-3-yl]phenyl]methanethiol |
|---|---|
| PubChem CID | 10490065 |
| Molecular Formula | C11H11NOS2 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | [4-[5-(sulfanylmethyl)-1,2-oxazol-3-yl]phenyl]methanethiol |
| SMILES | SCc1ccc(-c2cc(CS)on2)cc1 |
| InChI | InChI=1S/C11H11NOS2/c14-6-8-1-3-9(4-2-8)11-5-10(7-15)13-12-11/h1-5,14-15H,6-7H2 |
| InChIKey | BHFKUQZWYQTZLU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 26.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|