C11H10NNaO3S — CID 165455866
sodium [3-(4-methylphenyl)-1,2-oxazol-5-yl]methanesulfinate (PubChem CID 165455866) has the molecular formula C11H10NNaO3S and a molecular weight of 259.26 g/mol. Its IUPAC name is sodium [3-(4-methylphenyl)-1,2-oxazol-5-yl]methanesulfinate.
| Compound Name | sodium [3-(4-methylphenyl)-1,2-oxazol-5-yl]methanesulfinate |
|---|---|
| PubChem CID | 165455866 |
| Molecular Formula | C11H10NNaO3S |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | sodium [3-(4-methylphenyl)-1,2-oxazol-5-yl]methanesulfinate |
| SMILES | Cc1ccc(-c2cc(CS(=O)[O-])on2)cc1.[Na+] |
| InChI | InChI=1S/C11H11NO3S.Na/c1-8-2-4-9(5-3-8)11-6-10(15-12-11)7-16(13)14;/h2-6H,7H2,1H3,(H,13,14);/q;+1/p-1 |
| InChIKey | DNLGDLXZECCHFT-UHFFFAOYSA-M |
| XLogP | -0.97 |
| TPSA | 66.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|