sodium [3-(4-methylphenyl)-1,2-oxazol-5-yl]methanesulfinate

C11H10NNaO3S — CID 165455866

IUPACsodium [3-(4-methylphenyl)-1,2-oxazol-5-yl]methanesulfinate
SMILESCc1ccc(-c2cc(CS(=O)[O-])on2)cc1.[Na+]
InChIInChI=1S/C11H11NO3S.Na/c1-8-2-4-9(5-3-8)11-6-10(15-12-11)7-16(13)14;/h2-6H,7H2,1H3,(H,13,14);/q;+1/p-1
InChIKeyDNLGDLXZECCHFT-UHFFFAOYSA-M
MW259.26 g/mol
LogP-0.97
Rot. Bonds3

About sodium [3-(4-methylphenyl)-1,2-oxazol-5-yl]methanesulfinate

sodium [3-(4-methylphenyl)-1,2-oxazol-5-yl]methanesulfinate (PubChem CID 165455866) has the molecular formula C11H10NNaO3S and a molecular weight of 259.26 g/mol. Its IUPAC name is sodium [3-(4-methylphenyl)-1,2-oxazol-5-yl]methanesulfinate.

Molecular Properties

Compound Namesodium [3-(4-methylphenyl)-1,2-oxazol-5-yl]methanesulfinate
PubChem CID165455866
Molecular FormulaC11H10NNaO3S
Molecular Weight259.26 g/mol
Exact Mass259.03
IUPAC Namesodium [3-(4-methylphenyl)-1,2-oxazol-5-yl]methanesulfinate
SMILESCc1ccc(-c2cc(CS(=O)[O-])on2)cc1.[Na+]
InChIInChI=1S/C11H11NO3S.Na/c1-8-2-4-9(5-3-8)11-6-10(15-12-11)7-16(13)14;/h2-6H,7H2,1H3,(H,13,14);/q;+1/p-1
InChIKeyDNLGDLXZECCHFT-UHFFFAOYSA-M
XLogP-0.97
TPSA66.16 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.26
LogP ≤ 5-0.97
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze sodium [3-(4-methylphenyl)-1,2-oxazol-5-yl]methanesulfinate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium [3-(4-methylphenyl)-1,2-oxazol-5-yl]methanesulfinate?
The IUPAC name of sodium [3-(4-methylphenyl)-1,2-oxazol-5-yl]methanesulfinate (CID 165455866) is sodium [3-(4-methylphenyl)-1,2-oxazol-5-yl]methanesulfinate.
What is the SMILES notation for sodium [3-(4-methylphenyl)-1,2-oxazol-5-yl]methanesulfinate?
The canonical SMILES for sodium [3-(4-methylphenyl)-1,2-oxazol-5-yl]methanesulfinate is Cc1ccc(-c2cc(CS(=O)[O-])on2)cc1.[Na+].
What is the InChIKey of sodium [3-(4-methylphenyl)-1,2-oxazol-5-yl]methanesulfinate?
The InChIKey is DNLGDLXZECCHFT-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H11NO3S.Na/c1-8-2-4-9(5-3-8)11-6-10(15-12-11)7-16(13)14;/h2-6H,7H2,1H3,(H,13,14);/q;+1/p-1.
What are the key properties of sodium [3-(4-methylphenyl)-1,2-oxazol-5-yl]methanesulfinate?
sodium [3-(4-methylphenyl)-1,2-oxazol-5-yl]methanesulfinate has a molecular weight of 259.26 g/mol, XLogP of -0.97, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium [3-(4-methylphenyl)-1,2-oxazol-5-yl]methanesulfinate is sourced from PubChem (CID 165455866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).