C10H6Cl2INO — CID 119091467
3-(3,4-dichlorophenyl)-5-(iodomethyl)-1,2-oxazole (PubChem CID 119091467) has the molecular formula C10H6Cl2INO and a molecular weight of 353.97 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-5-(iodomethyl)-1,2-oxazole.
| Compound Name | 3-(3,4-dichlorophenyl)-5-(iodomethyl)-1,2-oxazole |
|---|---|
| PubChem CID | 119091467 |
| Molecular Formula | C10H6Cl2INO |
| Molecular Weight | 353.97 g/mol |
| Exact Mass | 352.89 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-5-(iodomethyl)-1,2-oxazole |
| SMILES | Clc1ccc(-c2cc(CI)on2)cc1Cl |
| InChI | InChI=1S/C10H6Cl2INO/c11-8-2-1-6(3-9(8)12)10-4-7(5-13)15-14-10/h1-4H,5H2 |
| InChIKey | AGADEWZMCQNBSN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.97 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|